C15H14F3N3O3 — CID 155645798
amino 3-[5-[2-methyl-4-(trifluoromethoxy)phenyl]pyridazin-3-yl]propanoate (PubChem CID 155645798) has the molecular formula C15H14F3N3O3 and a molecular weight of 341.29 g/mol. Its IUPAC name is amino 3-[5-[2-methyl-4-(trifluoromethoxy)phenyl]pyridazin-3-yl]propanoate.
| Compound Name | amino 3-[5-[2-methyl-4-(trifluoromethoxy)phenyl]pyridazin-3-yl]propanoate |
|---|---|
| PubChem CID | 155645798 |
| Molecular Formula | C15H14F3N3O3 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | amino 3-[5-[2-methyl-4-(trifluoromethoxy)phenyl]pyridazin-3-yl]propanoate |
| SMILES | Cc1cc(OC(F)(F)F)ccc1-c1cnnc(CCC(=O)ON)c1 |
| InChI | InChI=1S/C15H14F3N3O3/c1-9-6-12(23-15(16,17)18)3-4-13(9)10-7-11(21-20-8-10)2-5-14(22)24-19/h3-4,6-8H,2,5,19H2,1H3 |
| InChIKey | BZLKBCOWCFRKGG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|