C18H11F5N2O2Se — CID 87153120
4-(2,6-difluorophenyl)-5-[2-methyl-4-(trifluoromethoxy)phenyl]-1,3-selenazole-2-carboxamide (PubChem CID 87153120) has the molecular formula C18H11F5N2O2Se and a molecular weight of 461.25 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-5-[2-methyl-4-(trifluoromethoxy)phenyl]-1,3-selenazole-2-carboxamide.
| Compound Name | 4-(2,6-difluorophenyl)-5-[2-methyl-4-(trifluoromethoxy)phenyl]-1,3-selenazole-2-carboxamide |
|---|---|
| PubChem CID | 87153120 |
| Molecular Formula | C18H11F5N2O2Se |
| Molecular Weight | 461.25 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 4-(2,6-difluorophenyl)-5-[2-methyl-4-(trifluoromethoxy)phenyl]-1,3-selenazole-2-carboxamide |
| SMILES | Cc1cc(OC(F)(F)F)ccc1-c1[se]c(C(N)=O)nc1-c1c(F)cccc1F |
| InChI | InChI=1S/C18H11F5N2O2Se/c1-8-7-9(27-18(21,22)23)5-6-10(8)15-14(25-17(28-15)16(24)26)13-11(19)3-2-4-12(13)20/h2-7H,1H3,(H2,24,26) |
| InChIKey | UOFNOBJYWAPVOC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|