About CID 155646142
CID 155646142 (PubChem CID 155646142) has the molecular formula C18H19BFN4O3
and a molecular weight of 369.19 g/mol.
Molecular Properties
| Compound Name | CID 155646142 |
| PubChem CID | 155646142 |
| Molecular Formula | C18H19BFN4O3 |
| Molecular Weight | 369.19 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | — |
| SMILES | O=C[B]N1CCN(c2cccc(NCc3cccc(F)c3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H19BFN4O3/c20-15-4-1-3-14(11-15)12-21-16-5-2-6-17(18(16)24(26)27)22-7-9-23(10-8-22)19-13-25/h1-6,11,13,21H,7-10,12H2 |
| InChIKey | LTNGFNACMNQYTA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 155646142 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155646142?
The IUPAC name of CID 155646142 (CID 155646142) is not available.
What is the SMILES notation for CID 155646142?
The canonical SMILES for CID 155646142 is O=C[B]N1CCN(c2cccc(NCc3cccc(F)c3)c2[N+](=O)[O-])CC1.
What is the InChIKey of CID 155646142?
The InChIKey is LTNGFNACMNQYTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BFN4O3/c20-15-4-1-3-14(11-15)12-21-16-5-2-6-17(18(16)24(26)27)22-7-9-23(10-8-22)19-13-25/h1-6,11,13,21H,7-10,12H2.
What are the key properties of CID 155646142?
CID 155646142 has a molecular weight of 369.19 g/mol, XLogP of 2.28, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155646142 is sourced from PubChem (CID 155646142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).