C19H21BF2N3O3 — CID 158089501
CID 158089501 (PubChem CID 158089501) has the molecular formula C19H21BF2N3O3 and a molecular weight of 388.20 g/mol.
| Compound Name | CID 158089501 |
|---|---|
| PubChem CID | 158089501 |
| Molecular Formula | C19H21BF2N3O3 |
| Molecular Weight | 388.20 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | — |
| SMILES | C=C/C(F)=C(F)\C=C\CCc1cccc(N2CCN([B]C=O)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21BF2N3O3/c1-2-16(21)17(22)8-4-3-6-15-7-5-9-18(19(15)25(27)28)23-10-12-24(13-11-23)20-14-26/h2,4-5,7-9,14H,1,3,6,10-13H2/b8-4+,17-16- |
| InChIKey | CRQGUWPQQBTUFH-ZBRDQRSESA-N |
| XLogP | 3.35 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|