C24H31NO6Si — CID 155649067
(3E,4S)-4-(3-hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)-3-(2-trimethylsilylethylidene)azetidin-2-one (PubChem CID 155649067) has the molecular formula C24H31NO6Si and a molecular weight of 457.60 g/mol. Its IUPAC name is (3E,4S)-4-(3-hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)-3-(2-trimethylsilylethylidene)azetidin-2-one.
| Compound Name | (3E,4S)-4-(3-hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)-3-(2-trimethylsilylethylidene)azetidin-2-one |
|---|---|
| PubChem CID | 155649067 |
| Molecular Formula | C24H31NO6Si |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (3E,4S)-4-(3-hydroxy-4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)-3-(2-trimethylsilylethylidene)azetidin-2-one |
| SMILES | COc1ccc([C@H]2/C(=C\C[Si](C)(C)C)C(=O)N2c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C24H31NO6Si/c1-28-19-9-8-15(12-18(19)26)22-17(10-11-32(5,6)7)24(27)25(22)16-13-20(29-2)23(31-4)21(14-16)30-3/h8-10,12-14,22,26H,11H2,1-7H3/b17-10+/t22-/m0/s1 |
| InChIKey | QACJBBDHTOMNPL-BPNKPRMTSA-N |
| XLogP | 4.78 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|