C18H21N7O — CID 155649688
cyclopropyl-[(2R)-4-[5-isocyano-4-(1-methylpyrazol-4-yl)pyrimidin-2-yl]-2-methylpiperazin-1-yl]methanone (PubChem CID 155649688) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is cyclopropyl-[(2R)-4-[5-isocyano-4-(1-methylpyrazol-4-yl)pyrimidin-2-yl]-2-methylpiperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[(2R)-4-[5-isocyano-4-(1-methylpyrazol-4-yl)pyrimidin-2-yl]-2-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 155649688 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | cyclopropyl-[(2R)-4-[5-isocyano-4-(1-methylpyrazol-4-yl)pyrimidin-2-yl]-2-methylpiperazin-1-yl]methanone |
| SMILES | [C-]#[N+]c1cnc(N2CCN(C(=O)C3CC3)[C@H](C)C2)nc1-c1cnn(C)c1 |
| InChI | InChI=1S/C18H21N7O/c1-12-10-24(6-7-25(12)17(26)13-4-5-13)18-20-9-15(19-2)16(22-18)14-8-21-23(3)11-14/h8-9,11-13H,4-7,10H2,1,3H3/t12-/m1/s1 |
| InChIKey | LJFKTLCAHPWUQX-GFCCVEGCSA-N |
| XLogP | 1.87 |
| TPSA | 71.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|