C37H29N3O2PtS — CID 155650066
CID 155650066 (PubChem CID 155650066) has the molecular formula C37H29N3O2PtS and a molecular weight of 774.80 g/mol.
| Compound Name | CID 155650066 |
|---|---|
| PubChem CID | 155650066 |
| Molecular Formula | C37H29N3O2PtS |
| Molecular Weight | 774.80 g/mol |
| Exact Mass | 774.16 |
| IUPAC Name | — |
| SMILES | CC(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)oc4sc6cc(C(C)(C)C)cnc6c45)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C37H29N3O2S.Pt/c1-21(2)22-14-15-38-33(16-22)40-29-9-7-6-8-26(29)27-12-10-25(19-30(27)40)41-24-11-13-31-28(18-24)34-35-32(43-36(34)42-31)17-23(20-39-35)37(3,4)5;/h6-17,20-21H,1-5H3;/q-2;+2 |
| InChIKey | DODVIAWTHIOZEI-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.80 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|