C36H27N3O2PtS — CID 155650077
CID 155650077 (PubChem CID 155650077) has the molecular formula C36H27N3O2PtS and a molecular weight of 760.78 g/mol.
| Compound Name | CID 155650077 |
|---|---|
| PubChem CID | 155650077 |
| Molecular Formula | C36H27N3O2PtS |
| Molecular Weight | 760.78 g/mol |
| Exact Mass | 760.15 |
| IUPAC Name | — |
| SMILES | Cc1cnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)sc4oc6cc(C(C)(C)C)cnc6c45)ccc3c3ccccc32)cc1C.[Pt+2] |
| InChI | InChI=1S/C36H27N3O2S.Pt/c1-20-14-32(37-18-21(20)2)39-28-9-7-6-8-25(28)26-12-10-24(17-29(26)39)40-23-11-13-31-27(16-23)33-34-30(41-35(33)42-31)15-22(19-38-34)36(3,4)5;/h6-15,18-19H,1-5H3;/q-2;+2 |
| InChIKey | SCWROZKBLIWFBY-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.78 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|