C42H32N4OPt+2 — CID 86343608
2-[3-tert-butyl-5-(4-phenylpyrazol-1-yl)benzene-6-id-1-yl]oxy-9-(4-phenyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(4+) (PubChem CID 86343608) has the molecular formula C42H32N4OPt+2 and a molecular weight of 803.82 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-(4-phenylpyrazol-1-yl)benzene-6-id-1-yl]oxy-9-(4-phenyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(4+).
| Compound Name | 2-[3-tert-butyl-5-(4-phenylpyrazol-1-yl)benzene-6-id-1-yl]oxy-9-(4-phenyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(4+) |
|---|---|
| PubChem CID | 86343608 |
| Molecular Formula | C42H32N4OPt+2 |
| Molecular Weight | 803.82 g/mol |
| Exact Mass | 803.22 |
| IUPAC Name | 2-[3-tert-butyl-5-(4-phenylpyrazol-1-yl)benzene-6-id-1-yl]oxy-9-(4-phenyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(4+) |
| SMILES | CC(C)(C)c1cc(Oc2[c-]c3c(cc2)c2ccccc2n3-c2cc(-c3ccccc3)ccn2)[c-]c(-n2cc(-c3ccccc3)cn2)c1.[Pt+4] |
| InChI | InChI=1S/C42H32N4O.Pt/c1-42(2,3)33-23-34(45-28-32(27-44-45)30-14-8-5-9-15-30)25-36(24-33)47-35-18-19-38-37-16-10-11-17-39(37)46(40(38)26-35)41-22-31(20-21-43-41)29-12-6-4-7-13-29;/h4-24,27-28H,1-3H3;/q-2;+4 |
| InChIKey | GOVZZXAWVCQLBO-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.82 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|