C10H8F3N3OS — CID 155653470
4-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]-2H-triazole (PubChem CID 155653470) has the molecular formula C10H8F3N3OS and a molecular weight of 275.26 g/mol. Its IUPAC name is 4-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]-2H-triazole.
| Compound Name | 4-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]-2H-triazole |
|---|---|
| PubChem CID | 155653470 |
| Molecular Formula | C10H8F3N3OS |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 4-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]-2H-triazole |
| SMILES | FC(F)(F)Sc1ccc(COc2cn[nH]n2)cc1 |
| InChI | InChI=1S/C10H8F3N3OS/c11-10(12,13)18-8-3-1-7(2-4-8)6-17-9-5-14-16-15-9/h1-5H,6H2,(H,14,15,16) |
| InChIKey | JKNDAVKETXTMLO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |