C17H12F3N3S — CID 155653503
4-[(E)-2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole (PubChem CID 155653503) has the molecular formula C17H12F3N3S and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-[(E)-2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole.
| Compound Name | 4-[(E)-2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole |
|---|---|
| PubChem CID | 155653503 |
| Molecular Formula | C17H12F3N3S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 4-[(E)-2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole |
| SMILES | FC(F)(F)Sc1ccc(-c2ccc(/C=C/c3cn[nH]n3)cc2)cc1 |
| InChI | InChI=1S/C17H12F3N3S/c18-17(19,20)24-16-9-6-14(7-10-16)13-4-1-12(2-5-13)3-8-15-11-21-23-22-15/h1-11H,(H,21,22,23)/b8-3+ |
| InChIKey | OBQPEVLIQFRLLP-FPYGCLRLSA-N |
| XLogP | 5.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |