C11H8F3N3S — CID 155653630
4-[(E)-2-[4-(trifluoromethylsulfanyl)phenyl]ethenyl]-2H-triazole (PubChem CID 155653630) has the molecular formula C11H8F3N3S and a molecular weight of 271.27 g/mol. Its IUPAC name is 4-[(E)-2-[4-(trifluoromethylsulfanyl)phenyl]ethenyl]-2H-triazole.
| Compound Name | 4-[(E)-2-[4-(trifluoromethylsulfanyl)phenyl]ethenyl]-2H-triazole |
|---|---|
| PubChem CID | 155653630 |
| Molecular Formula | C11H8F3N3S |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 4-[(E)-2-[4-(trifluoromethylsulfanyl)phenyl]ethenyl]-2H-triazole |
| SMILES | FC(F)(F)Sc1ccc(/C=C/c2cn[nH]n2)cc1 |
| InChI | InChI=1S/C11H8F3N3S/c12-11(13,14)18-10-5-2-8(3-6-10)1-4-9-7-15-17-16-9/h1-7H,(H,15,16,17)/b4-1+ |
| InChIKey | CEMNGDMSEYQREY-DAFODLJHSA-N |
| XLogP | 3.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |