C16H12F5N3S — CID 155653638
pentafluoro-[4-[4-[(E)-2-(2H-triazol-4-yl)ethenyl]phenyl]phenyl]-λ6-sulfane (PubChem CID 155653638) has the molecular formula C16H12F5N3S and a molecular weight of 373.35 g/mol. Its IUPAC name is pentafluoro-[4-[4-[(E)-2-(2H-triazol-4-yl)ethenyl]phenyl]phenyl]-λ6-sulfane.
| Compound Name | pentafluoro-[4-[4-[(E)-2-(2H-triazol-4-yl)ethenyl]phenyl]phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 155653638 |
| Molecular Formula | C16H12F5N3S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | pentafluoro-[4-[4-[(E)-2-(2H-triazol-4-yl)ethenyl]phenyl]phenyl]-λ6-sulfane |
| SMILES | FS(F)(F)(F)(F)c1ccc(-c2ccc(/C=C/c3cn[nH]n3)cc2)cc1 |
| InChI | InChI=1S/C16H12F5N3S/c17-25(18,19,20,21)16-9-6-14(7-10-16)13-4-1-12(2-5-13)3-8-15-11-22-24-23-15/h1-11H,(H,22,23,24)/b8-3+ |
| InChIKey | SLZIFDGGUKPILW-FPYGCLRLSA-N |
| XLogP | 6.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |