C9H8F5N3S2 — CID 155653547
pentafluoro-[4-(2H-triazol-4-ylsulfanylmethyl)phenyl]-λ6-sulfane (PubChem CID 155653547) has the molecular formula C9H8F5N3S2 and a molecular weight of 317.31 g/mol. Its IUPAC name is pentafluoro-[4-(2H-triazol-4-ylsulfanylmethyl)phenyl]-λ6-sulfane.
| Compound Name | pentafluoro-[4-(2H-triazol-4-ylsulfanylmethyl)phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 155653547 |
| Molecular Formula | C9H8F5N3S2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | pentafluoro-[4-(2H-triazol-4-ylsulfanylmethyl)phenyl]-λ6-sulfane |
| SMILES | FS(F)(F)(F)(F)c1ccc(CSc2cn[nH]n2)cc1 |
| InChI | InChI=1S/C9H8F5N3S2/c10-19(11,12,13,14)8-3-1-7(2-4-8)6-18-9-5-15-17-16-9/h1-5H,6H2,(H,15,16,17) |
| InChIKey | MJPUXXSUBIQCTC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |