C67H33F3N8 — CID 155654203
2,6-bis[2-(2-cyanophenyl)-7-(2-isocyanophenyl)carbazol-9-yl]-4-[3-isocyano-5-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 155654203) has the molecular formula C67H33F3N8 and a molecular weight of 1007.05 g/mol. Its IUPAC name is 2,6-bis[2-(2-cyanophenyl)-7-(2-isocyanophenyl)carbazol-9-yl]-4-[3-isocyano-5-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,6-bis[2-(2-cyanophenyl)-7-(2-isocyanophenyl)carbazol-9-yl]-4-[3-isocyano-5-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155654203 |
| Molecular Formula | C67H33F3N8 |
| Molecular Weight | 1007.05 g/mol |
| Exact Mass | 1006.28 |
| IUPAC Name | 2,6-bis[2-(2-cyanophenyl)-7-(2-isocyanophenyl)carbazol-9-yl]-4-[3-isocyano-5-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2cc(-n3c4cc(-c5ccccc5C#N)ccc4c4ccc(-c5ccccc5[N+]#[C-])cc43)c(C#N)c(-n3c4cc(-c5ccccc5C#N)ccc4c4ccc(-c5ccccc5[N+]#[C-])cc43)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C67H33F3N8/c1-74-49-29-46(28-48(36-49)67(68,69)70)47-34-65(77-61-30-40(50-14-6-4-12-44(50)37-71)20-24-54(61)56-26-22-42(32-63(56)77)52-16-8-10-18-59(52)75-2)58(39-73)66(35-47)78-62-31-41(51-15-7-5-13-45(51)38-72)21-25-55(62)57-27-23-43(33-64(57)78)53-17-9-11-19-60(53)76-3/h4-36H |
| InChIKey | XJVHAZZOVHFFRM-UHFFFAOYSA-N |
| XLogP | 18.50 |
| TPSA | 94.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.05 |
| LogP ≤ 5 | 18.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|