C21H38NO6+ — CID 155656961
[2-hydroxy-3-[4-(2-hydroxy-3-methoxypropoxy)butoxy]propyl]-dimethyl-(2-phenoxyethyl)azanium (PubChem CID 155656961) has the molecular formula C21H38NO6+ and a molecular weight of 400.54 g/mol. Its IUPAC name is [2-hydroxy-3-[4-(2-hydroxy-3-methoxypropoxy)butoxy]propyl]-dimethyl-(2-phenoxyethyl)azanium.
| Compound Name | [2-hydroxy-3-[4-(2-hydroxy-3-methoxypropoxy)butoxy]propyl]-dimethyl-(2-phenoxyethyl)azanium |
|---|---|
| PubChem CID | 155656961 |
| Molecular Formula | C21H38NO6+ |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | [2-hydroxy-3-[4-(2-hydroxy-3-methoxypropoxy)butoxy]propyl]-dimethyl-(2-phenoxyethyl)azanium |
| SMILES | COCC(O)COCCCCOCC(O)C[N+](C)(C)CCOc1ccccc1 |
| InChI | InChI=1S/C21H38NO6/c1-22(2,11-14-28-21-9-5-4-6-10-21)15-19(23)17-26-12-7-8-13-27-18-20(24)16-25-3/h4-6,9-10,19-20,23-24H,7-8,11-18H2,1-3H3/q+1 |
| InChIKey | PRGACUKCHAYHJY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|