About CID 155657955
CID 155657955 (PubChem CID 155657955) has the molecular formula C9H13GeO2
and a molecular weight of 225.81 g/mol.
Molecular Properties
| Compound Name | CID 155657955 |
| PubChem CID | 155657955 |
| Molecular Formula | C9H13GeO2 |
| Molecular Weight | 225.81 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | — |
| SMILES | O=C(O)C1CC2CCC1([Ge])CC2 |
| InChI | InChI=1S/C9H13GeO2/c10-9-3-1-6(2-4-9)5-7(9)8(11)12/h6-7H,1-5H2,(H,11,12) |
| InChIKey | SIYOJEVSRIBKKH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.81 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 155657955 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155657955?
The IUPAC name of CID 155657955 (CID 155657955) is not available.
What is the SMILES notation for CID 155657955?
The canonical SMILES for CID 155657955 is O=C(O)C1CC2CCC1([Ge])CC2.
What is the InChIKey of CID 155657955?
The InChIKey is SIYOJEVSRIBKKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13GeO2/c10-9-3-1-6(2-4-9)5-7(9)8(11)12/h6-7H,1-5H2,(H,11,12).
What are the key properties of CID 155657955?
CID 155657955 has a molecular weight of 225.81 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155657955 is sourced from PubChem (CID 155657955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).