C10H12O8 — CID 123838414
cis-(2S,4S)-cyclohexane-1,1,2,4-tetracarboxylic acid (PubChem CID 123838414) has the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. Its IUPAC name is cis-(2S,4S)-cyclohexane-1,1,2,4-tetracarboxylic acid.
| Compound Name | cis-(2S,4S)-cyclohexane-1,1,2,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 123838414 |
| Molecular Formula | C10H12O8 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | cis-(2S,4S)-cyclohexane-1,1,2,4-tetracarboxylic acid |
| SMILES | O=C(O)[C@H]1CCC(C(=O)O)(C(=O)O)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C10H12O8/c11-6(12)4-1-2-10(8(15)16,9(17)18)5(3-4)7(13)14/h4-5H,1-3H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)/t4-,5+/m0/s1 |
| InChIKey | KVQXWDNOTUTGJD-CRCLSJGQSA-N |
| XLogP | -0.27 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|