C8H14N2O4 — CID 54492564
1,2-diaminocyclohexane-1,4-dicarboxylic acid (PubChem CID 54492564) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is 1,2-diaminocyclohexane-1,4-dicarboxylic acid.
| Compound Name | 1,2-diaminocyclohexane-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 54492564 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1,2-diaminocyclohexane-1,4-dicarboxylic acid |
| SMILES | NC1CC(C(=O)O)CCC1(N)C(=O)O |
| InChI | InChI=1S/C8H14N2O4/c9-5-3-4(6(11)12)1-2-8(5,10)7(13)14/h4-5H,1-3,9-10H2,(H,11,12)(H,13,14) |
| InChIKey | XWTLCRDKJIROJI-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |