C12H23NO2S — CID 79588358
1-amino-2-(2-tert-butylsulfanylethyl)cyclopentane-1-carboxylic acid (PubChem CID 79588358) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is 1-amino-2-(2-tert-butylsulfanylethyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-amino-2-(2-tert-butylsulfanylethyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 79588358 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 1-amino-2-(2-tert-butylsulfanylethyl)cyclopentane-1-carboxylic acid |
| SMILES | CC(C)(C)SCCC1CCCC1(N)C(=O)O |
| InChI | InChI=1S/C12H23NO2S/c1-11(2,3)16-8-6-9-5-4-7-12(9,13)10(14)15/h9H,4-8,13H2,1-3H3,(H,14,15) |
| InChIKey | WWSOVFFOPOPYQC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |