C12H23NO3S — CID 107771724
1-amino-2-[2-(3-hydroxybutan-2-ylsulfanyl)ethyl]cyclopentane-1-carboxylic acid (PubChem CID 107771724) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 1-amino-2-[2-(3-hydroxybutan-2-ylsulfanyl)ethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-amino-2-[2-(3-hydroxybutan-2-ylsulfanyl)ethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 107771724 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-amino-2-[2-(3-hydroxybutan-2-ylsulfanyl)ethyl]cyclopentane-1-carboxylic acid |
| SMILES | CC(O)C(C)SCCC1CCCC1(N)C(=O)O |
| InChI | InChI=1S/C12H23NO3S/c1-8(14)9(2)17-7-5-10-4-3-6-12(10,13)11(15)16/h8-10,14H,3-7,13H2,1-2H3,(H,15,16) |
| InChIKey | SQUMTAGOPJXHGF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |