C41H32F6O10S2 — CID 155658671
methyl 3-ethyl-4-[2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethyl]-2-[(E)-3-[3-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]phenyl]prop-2-enoyl]oxybenzoate (PubChem CID 155658671) has the molecular formula C41H32F6O10S2 and a molecular weight of 862.82 g/mol. Its IUPAC name is methyl 3-ethyl-4-[2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethyl]-2-[(E)-3-[3-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]phenyl]prop-2-enoyl]oxybenzoate.
| Compound Name | methyl 3-ethyl-4-[2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethyl]-2-[(E)-3-[3-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]phenyl]prop-2-enoyl]oxybenzoate |
|---|---|
| PubChem CID | 155658671 |
| Molecular Formula | C41H32F6O10S2 |
| Molecular Weight | 862.82 g/mol |
| Exact Mass | 862.13 |
| IUPAC Name | methyl 3-ethyl-4-[2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethyl]-2-[(E)-3-[3-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]phenyl]prop-2-enoyl]oxybenzoate |
| SMILES | CCc1c(CCc2cccc3c2C(OS(=O)(=O)C(F)(F)F)=CC3)ccc(C(=O)OC)c1OC(=O)/C=C/c1cccc(-c2cccc3c2C(OS(=O)(=O)C(F)(F)F)=CC3)c1 |
| InChI | InChI=1S/C41H32F6O10S2/c1-3-30-25(14-15-26-8-5-9-27-17-20-33(36(26)27)56-58(50,51)40(42,43)44)16-19-32(39(49)54-2)38(30)55-35(48)22-13-24-7-4-11-29(23-24)31-12-6-10-28-18-21-34(37(28)31)57-59(52,53)41(45,46)47/h4-13,16,19-23H,3,14-15,17-18H2,1-2H3/b22-13+ |
| InChIKey | CQSDDGDLUMPPFX-LPYMAVHISA-N |
| XLogP | 8.63 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.82 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|