About CID 155659278
CID 155659278 (PubChem CID 155659278) has the molecular formula C18H37O4Si2
and a molecular weight of 373.66 g/mol.
Molecular Properties
| Compound Name | CID 155659278 |
| PubChem CID | 155659278 |
| Molecular Formula | C18H37O4Si2 |
| Molecular Weight | 373.66 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | — |
| SMILES | CCO[Si](OCC)C(C)(CC)C(=O)O[Si](CC)(CC)C1CCCC1 |
| InChI | InChI=1S/C18H37O4Si2/c1-7-18(6,23(20-8-2)21-9-3)17(19)22-24(10-4,11-5)16-14-12-13-15-16/h16H,7-15H2,1-6H3 |
| InChIKey | SQEOLYYICNCVRD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155659278 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155659278?
The IUPAC name of CID 155659278 (CID 155659278) is not available.
What is the SMILES notation for CID 155659278?
The canonical SMILES for CID 155659278 is CCO[Si](OCC)C(C)(CC)C(=O)O[Si](CC)(CC)C1CCCC1.
What is the InChIKey of CID 155659278?
The InChIKey is SQEOLYYICNCVRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37O4Si2/c1-7-18(6,23(20-8-2)21-9-3)17(19)22-24(10-4,11-5)16-14-12-13-15-16/h16H,7-15H2,1-6H3.
What are the key properties of CID 155659278?
CID 155659278 has a molecular weight of 373.66 g/mol, XLogP of 5.19, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155659278 is sourced from PubChem (CID 155659278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).