About CID 155659343
CID 155659343 (PubChem CID 155659343) has the molecular formula C21H41O4Si2
and a molecular weight of 413.73 g/mol.
Molecular Properties
| Compound Name | CID 155659343 |
| PubChem CID | 155659343 |
| Molecular Formula | C21H41O4Si2 |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | — |
| SMILES | CCC(C)(C(=O)O[Si](CC)(C1CCCCC1)C1CCCCC1)[Si](OC)OC |
| InChI | InChI=1S/C21H41O4Si2/c1-6-21(3,26(23-4)24-5)20(22)25-27(7-2,18-14-10-8-11-15-18)19-16-12-9-13-17-19/h18-19H,6-17H2,1-5H3 |
| InChIKey | NXAYYOOXEJDOAA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155659343 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155659343?
The IUPAC name of CID 155659343 (CID 155659343) is not available.
What is the SMILES notation for CID 155659343?
The canonical SMILES for CID 155659343 is CCC(C)(C(=O)O[Si](CC)(C1CCCCC1)C1CCCCC1)[Si](OC)OC.
What is the InChIKey of CID 155659343?
The InChIKey is NXAYYOOXEJDOAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41O4Si2/c1-6-21(3,26(23-4)24-5)20(22)25-27(7-2,18-14-10-8-11-15-18)19-16-12-9-13-17-19/h18-19H,6-17H2,1-5H3.
What are the key properties of CID 155659343?
CID 155659343 has a molecular weight of 413.73 g/mol, XLogP of 6.11, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155659343 is sourced from PubChem (CID 155659343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).