C41H56O6 — CID 155660006
1-cyclohexylpropan-2-yl 2-[10-[2-(1-cyclohexylpropan-2-yloxy)-2-oxoethoxy]-3-pentylanthracen-9-yl]oxyacetate (PubChem CID 155660006) has the molecular formula C41H56O6 and a molecular weight of 644.89 g/mol. Its IUPAC name is 1-cyclohexylpropan-2-yl 2-[10-[2-(1-cyclohexylpropan-2-yloxy)-2-oxoethoxy]-3-pentylanthracen-9-yl]oxyacetate.
| Compound Name | 1-cyclohexylpropan-2-yl 2-[10-[2-(1-cyclohexylpropan-2-yloxy)-2-oxoethoxy]-3-pentylanthracen-9-yl]oxyacetate |
|---|---|
| PubChem CID | 155660006 |
| Molecular Formula | C41H56O6 |
| Molecular Weight | 644.89 g/mol |
| Exact Mass | 644.41 |
| IUPAC Name | 1-cyclohexylpropan-2-yl 2-[10-[2-(1-cyclohexylpropan-2-yloxy)-2-oxoethoxy]-3-pentylanthracen-9-yl]oxyacetate |
| SMILES | CCCCCc1ccc2c(OCC(=O)OC(C)CC3CCCCC3)c3ccccc3c(OCC(=O)OC(C)CC3CCCCC3)c2c1 |
| InChI | InChI=1S/C41H56O6/c1-4-5-8-15-33-22-23-36-37(26-33)41(45-28-39(43)47-30(3)25-32-18-11-7-12-19-32)35-21-14-13-20-34(35)40(36)44-27-38(42)46-29(2)24-31-16-9-6-10-17-31/h13-14,20-23,26,29-32H,4-12,15-19,24-25,27-28H2,1-3H3 |
| InChIKey | TWZUGAWZZPPWEM-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.89 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|