C18H22ClN3O3 — CID 155660588
propyl 2-[(2-chlorophenyl)methyl-(imidazole-1-carbonyl)amino]-2-methylpropanoate (PubChem CID 155660588) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is propyl 2-[(2-chlorophenyl)methyl-(imidazole-1-carbonyl)amino]-2-methylpropanoate.
| Compound Name | propyl 2-[(2-chlorophenyl)methyl-(imidazole-1-carbonyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 155660588 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | propyl 2-[(2-chlorophenyl)methyl-(imidazole-1-carbonyl)amino]-2-methylpropanoate |
| SMILES | CCCOC(=O)C(C)(C)N(Cc1ccccc1Cl)C(=O)n1ccnc1 |
| InChI | InChI=1S/C18H22ClN3O3/c1-4-11-25-16(23)18(2,3)22(17(24)21-10-9-20-13-21)12-14-7-5-6-8-15(14)19/h5-10,13H,4,11-12H2,1-3H3 |
| InChIKey | HQWZEOFXABRVNV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |