C16H21ClN4 — CID 87389277
N-[(E)-[(2-chlorophenyl)-imidazol-1-ylmethylidene]amino]-N-propylpropan-1-amine (PubChem CID 87389277) has the molecular formula C16H21ClN4 and a molecular weight of 304.82 g/mol. Its IUPAC name is N-[(E)-[(2-chlorophenyl)-imidazol-1-ylmethylidene]amino]-N-propylpropan-1-amine.
| Compound Name | N-[(E)-[(2-chlorophenyl)-imidazol-1-ylmethylidene]amino]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 87389277 |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-[(E)-[(2-chlorophenyl)-imidazol-1-ylmethylidene]amino]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)/N=C(\c1ccccc1Cl)n1ccnc1 |
| InChI | InChI=1S/C16H21ClN4/c1-3-10-21(11-4-2)19-16(20-12-9-18-13-20)14-7-5-6-8-15(14)17/h5-9,12-13H,3-4,10-11H2,1-2H3/b19-16+ |
| InChIKey | QLWXDZFQPVVTRV-KNTRCKAVSA-N |
| XLogP | 3.87 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|