C22H25ClN4 — CID 67414712
4-tert-butyl-N-[[(2-chlorophenyl)-imidazol-1-ylmethylidene]amino]-N-ethylaniline (PubChem CID 67414712) has the molecular formula C22H25ClN4 and a molecular weight of 380.92 g/mol. Its IUPAC name is 4-tert-butyl-N-[[(2-chlorophenyl)-imidazol-1-ylmethylidene]amino]-N-ethylaniline.
| Compound Name | 4-tert-butyl-N-[[(2-chlorophenyl)-imidazol-1-ylmethylidene]amino]-N-ethylaniline |
|---|---|
| PubChem CID | 67414712 |
| Molecular Formula | C22H25ClN4 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-tert-butyl-N-[[(2-chlorophenyl)-imidazol-1-ylmethylidene]amino]-N-ethylaniline |
| SMILES | CCN(N=C(c1ccccc1Cl)n1ccnc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H25ClN4/c1-5-27(18-12-10-17(11-13-18)22(2,3)4)25-21(26-15-14-24-16-26)19-8-6-7-9-20(19)23/h6-16H,5H2,1-4H3 |
| InChIKey | FCPDSACYEUZSIX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|