C22H33ClN4 — CID 87390015
N-[(E)-[(2-chlorophenyl)-imidazol-1-ylmethylidene]amino]-N-hexylhexan-1-amine (PubChem CID 87390015) has the molecular formula C22H33ClN4 and a molecular weight of 388.99 g/mol. Its IUPAC name is N-[(E)-[(2-chlorophenyl)-imidazol-1-ylmethylidene]amino]-N-hexylhexan-1-amine.
| Compound Name | N-[(E)-[(2-chlorophenyl)-imidazol-1-ylmethylidene]amino]-N-hexylhexan-1-amine |
|---|---|
| PubChem CID | 87390015 |
| Molecular Formula | C22H33ClN4 |
| Molecular Weight | 388.99 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | N-[(E)-[(2-chlorophenyl)-imidazol-1-ylmethylidene]amino]-N-hexylhexan-1-amine |
| SMILES | CCCCCCN(CCCCCC)/N=C(\c1ccccc1Cl)n1ccnc1 |
| InChI | InChI=1S/C22H33ClN4/c1-3-5-7-11-16-27(17-12-8-6-4-2)25-22(26-18-15-24-19-26)20-13-9-10-14-21(20)23/h9-10,13-15,18-19H,3-8,11-12,16-17H2,1-2H3/b25-22+ |
| InChIKey | YULAJNJSRAWGNV-YYDJUVGSSA-N |
| XLogP | 6.21 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.99 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|