About azanium hex-5-ene-1-sulfonate
azanium hex-5-ene-1-sulfonate (PubChem CID 155661740) has the molecular formula C6H15NO3S
and a molecular weight of 181.26 g/mol. Its IUPAC name is azanium hex-5-ene-1-sulfonate.
Molecular Properties
| Compound Name | azanium hex-5-ene-1-sulfonate |
| PubChem CID | 155661740 |
| Molecular Formula | C6H15NO3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | azanium hex-5-ene-1-sulfonate |
| SMILES | C=CCCCCS(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C6H12O3S.H3N/c1-2-3-4-5-6-10(7,8)9;/h2H,1,3-6H2,(H,7,8,9);1H3 |
| InChIKey | XWPKPEUVIIEUTL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azanium hex-5-ene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium hex-5-ene-1-sulfonate?
The IUPAC name of azanium hex-5-ene-1-sulfonate (CID 155661740) is azanium hex-5-ene-1-sulfonate.
What is the SMILES notation for azanium hex-5-ene-1-sulfonate?
The canonical SMILES for azanium hex-5-ene-1-sulfonate is C=CCCCCS(=O)(=O)[O-].[NH4+].
What is the InChIKey of azanium hex-5-ene-1-sulfonate?
The InChIKey is XWPKPEUVIIEUTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3S.H3N/c1-2-3-4-5-6-10(7,8)9;/h2H,1,3-6H2,(H,7,8,9);1H3.
What are the key properties of azanium hex-5-ene-1-sulfonate?
azanium hex-5-ene-1-sulfonate has a molecular weight of 181.26 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium hex-5-ene-1-sulfonate is sourced from PubChem (CID 155661740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).