C28H24FN3O2 — CID 155663458
N-[(3-fluorophenyl)methyl]-1-[2-(1H-indol-3-yl)ethyl]-3-methylidene-4-oxo-2-phenylazetidine-2-carboxamide (PubChem CID 155663458) has the molecular formula C28H24FN3O2 and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-1-[2-(1H-indol-3-yl)ethyl]-3-methylidene-4-oxo-2-phenylazetidine-2-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-1-[2-(1H-indol-3-yl)ethyl]-3-methylidene-4-oxo-2-phenylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 155663458 |
| Molecular Formula | C28H24FN3O2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-1-[2-(1H-indol-3-yl)ethyl]-3-methylidene-4-oxo-2-phenylazetidine-2-carboxamide |
| SMILES | C=C1C(=O)N(CCc2c[nH]c3ccccc23)C1(C(=O)NCc1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C28H24FN3O2/c1-19-26(33)32(15-14-21-18-30-25-13-6-5-12-24(21)25)28(19,22-9-3-2-4-10-22)27(34)31-17-20-8-7-11-23(29)16-20/h2-13,16,18,30H,1,14-15,17H2,(H,31,34) |
| InChIKey | IGWUMLOJMKGLAS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|