C13H16ClN5 — CID 155663525
1-(2,2-diaminoethylidene)-2-naphthalen-2-ylguanidine;hydrochloride (PubChem CID 155663525) has the molecular formula C13H16ClN5 and a molecular weight of 277.76 g/mol. Its IUPAC name is 1-(2,2-diaminoethylidene)-2-naphthalen-2-ylguanidine;hydrochloride.
| Compound Name | 1-(2,2-diaminoethylidene)-2-naphthalen-2-ylguanidine;hydrochloride |
|---|---|
| PubChem CID | 155663525 |
| Molecular Formula | C13H16ClN5 |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-(2,2-diaminoethylidene)-2-naphthalen-2-ylguanidine;hydrochloride |
| SMILES | Cl.N/C(N=CC(N)N)=N\c1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H15N5.ClH/c14-12(15)8-17-13(16)18-11-6-5-9-3-1-2-4-10(9)7-11;/h1-8,12H,14-15H2,(H2,16,18);1H |
| InChIKey | ZKPYWMBDCJAYFC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|