C12H12BrF2NO2 — CID 155668078
2-[bromo(difluoro)methyl]-4-(4-methoxyphenyl)-1,3-dihydropyrrol-2-ol (PubChem CID 155668078) has the molecular formula C12H12BrF2NO2 and a molecular weight of 320.13 g/mol. Its IUPAC name is 2-[bromo(difluoro)methyl]-4-(4-methoxyphenyl)-1,3-dihydropyrrol-2-ol.
| Compound Name | 2-[bromo(difluoro)methyl]-4-(4-methoxyphenyl)-1,3-dihydropyrrol-2-ol |
|---|---|
| PubChem CID | 155668078 |
| Molecular Formula | C12H12BrF2NO2 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 2-[bromo(difluoro)methyl]-4-(4-methoxyphenyl)-1,3-dihydropyrrol-2-ol |
| SMILES | COc1ccc(C2=CNC(O)(C(F)(F)Br)C2)cc1 |
| InChI | InChI=1S/C12H12BrF2NO2/c1-18-10-4-2-8(3-5-10)9-6-11(17,16-7-9)12(13,14)15/h2-5,7,16-17H,6H2,1H3 |
| InChIKey | WRHAJHWZKLABTO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|