C11H10F3NO3 — CID 2881249
3-(4-methoxyphenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 2881249) has the molecular formula C11H10F3NO3 and a molecular weight of 261.20 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
| Compound Name | 3-(4-methoxyphenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 2881249 |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | COc1ccc(C2=NOC(O)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C11H10F3NO3/c1-17-8-4-2-7(3-5-8)9-6-10(16,18-15-9)11(12,13)14/h2-5,16H,6H2,1H3 |
| InChIKey | CTZBKVRKFPPKTE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |