C14H10F3NO2 — CID 690721
(5R)-3-naphthalen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 690721) has the molecular formula C14H10F3NO2 and a molecular weight of 281.23 g/mol. Its IUPAC name is (5R)-3-naphthalen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
| Compound Name | (5R)-3-naphthalen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 690721 |
| Molecular Formula | C14H10F3NO2 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (5R)-3-naphthalen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | O[C@]1(C(F)(F)F)CC(c2ccc3ccccc3c2)=NO1 |
| InChI | InChI=1S/C14H10F3NO2/c15-14(16,17)13(19)8-12(18-20-13)11-6-5-9-3-1-2-4-10(9)7-11/h1-7,19H,8H2/t13-/m1/s1 |
| InChIKey | LWSREXGTQFTMKI-CYBMUJFWSA-N |
| XLogP | 3.22 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |