C10H7F4NO2 — CID 67362753
3-(3-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 67362753) has the molecular formula C10H7F4NO2 and a molecular weight of 249.16 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
| Compound Name | 3-(3-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 67362753 |
| Molecular Formula | C10H7F4NO2 |
| Molecular Weight | 249.16 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 3-(3-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | OC1(C(F)(F)F)CC(c2cccc(F)c2)=NO1 |
| InChI | InChI=1S/C10H7F4NO2/c11-7-3-1-2-6(4-7)8-5-9(16,17-15-8)10(12,13)14/h1-4,16H,5H2 |
| InChIKey | YZWNFEGRQSVMOO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |