C16H12F3NO2S — CID 155413344
3-(4-phenylsulfanylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 155413344) has the molecular formula C16H12F3NO2S and a molecular weight of 339.34 g/mol. Its IUPAC name is 3-(4-phenylsulfanylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
| Compound Name | 3-(4-phenylsulfanylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 155413344 |
| Molecular Formula | C16H12F3NO2S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 3-(4-phenylsulfanylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | OC1(C(F)(F)F)CC(c2ccc(Sc3ccccc3)cc2)=NO1 |
| InChI | InChI=1S/C16H12F3NO2S/c17-16(18,19)15(21)10-14(20-22-15)11-6-8-13(9-7-11)23-12-4-2-1-3-5-12/h1-9,21H,10H2 |
| InChIKey | XRYYDDIQFOKEMB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |