C14H10F3N3O2 — CID 142608931
3-(4-pyrimidin-5-ylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 142608931) has the molecular formula C14H10F3N3O2 and a molecular weight of 309.25 g/mol. Its IUPAC name is 3-(4-pyrimidin-5-ylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
| Compound Name | 3-(4-pyrimidin-5-ylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 142608931 |
| Molecular Formula | C14H10F3N3O2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-(4-pyrimidin-5-ylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | OC1(C(F)(F)F)CC(c2ccc(-c3cncnc3)cc2)=NO1 |
| InChI | InChI=1S/C14H10F3N3O2/c15-14(16,17)13(21)5-12(20-22-13)10-3-1-9(2-4-10)11-6-18-8-19-7-11/h1-4,6-8,21H,5H2 |
| InChIKey | JHYDRWZSSKLKJS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |