C20H24F4N2O4 — CID 155668576
tert-butyl (3S,4S)-3-fluoro-4-[3-(2,3,5-trifluorophenyl)-1,2-oxazolidine-2-carbonyl]piperidine-1-carboxylate (PubChem CID 155668576) has the molecular formula C20H24F4N2O4 and a molecular weight of 432.41 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-fluoro-4-[3-(2,3,5-trifluorophenyl)-1,2-oxazolidine-2-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-fluoro-4-[3-(2,3,5-trifluorophenyl)-1,2-oxazolidine-2-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155668576 |
| Molecular Formula | C20H24F4N2O4 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | tert-butyl (3S,4S)-3-fluoro-4-[3-(2,3,5-trifluorophenyl)-1,2-oxazolidine-2-carbonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C(=O)N2OCCC2c2cc(F)cc(F)c2F)[C@H](F)C1 |
| InChI | InChI=1S/C20H24F4N2O4/c1-20(2,3)30-19(28)25-6-4-12(15(23)10-25)18(27)26-16(5-7-29-26)13-8-11(21)9-14(22)17(13)24/h8-9,12,15-16H,4-7,10H2,1-3H3/t12-,15-,16?/m1/s1 |
| InChIKey | GSYCPDCSUGUHRP-CEPMMTIFSA-N |
| XLogP | 3.90 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|