C30H38N4O7S — CID 155672007
1-[(2R,4R)-2,4-dihydroxy-1-[(2R)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,4-dihydrothieno[2,3-d]pyrimidin-3-yl]cyclopentane-1-carboxamide (PubChem CID 155672007) has the molecular formula C30H38N4O7S and a molecular weight of 598.72 g/mol. Its IUPAC name is 1-[(2R,4R)-2,4-dihydroxy-1-[(2R)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,4-dihydrothieno[2,3-d]pyrimidin-3-yl]cyclopentane-1-carboxamide.
| Compound Name | 1-[(2R,4R)-2,4-dihydroxy-1-[(2R)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,4-dihydrothieno[2,3-d]pyrimidin-3-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 155672007 |
| Molecular Formula | C30H38N4O7S |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | 1-[(2R,4R)-2,4-dihydroxy-1-[(2R)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,4-dihydrothieno[2,3-d]pyrimidin-3-yl]cyclopentane-1-carboxamide |
| SMILES | COc1ccccc1[C@H](CN1c2sc(-c3ncco3)c(C)c2[C@@H](O)N(C2(C(N)=O)CCCC2)[C@H]1O)OC1CCOCC1 |
| InChI | InChI=1S/C30H38N4O7S/c1-18-23-26(35)34(30(28(31)36)11-5-6-12-30)29(37)33(27(23)42-24(18)25-32-13-16-40-25)17-22(41-19-9-14-39-15-10-19)20-7-3-4-8-21(20)38-2/h3-4,7-8,13,16,19,22,26,29,35,37H,5-6,9-12,14-15,17H2,1-2H3,(H2,31,36)/t22-,26+,29-/m0/s1 |
| InChIKey | SOEKSWBQRPNACN-FATZWSQISA-N |
| XLogP | 3.84 |
| TPSA | 143.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |