C28H34N4O7S — CID 175745489
3-[[4-[(2S)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-7-methyl-6-(1,3-oxazol-2-yl)thieno[2,3-e][1,3,2,4]dioxadiazin-2-yl]methyl]cyclobutane-1-carboxamide (PubChem CID 175745489) has the molecular formula C28H34N4O7S and a molecular weight of 570.67 g/mol. Its IUPAC name is 3-[[4-[(2S)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-7-methyl-6-(1,3-oxazol-2-yl)thieno[2,3-e][1,3,2,4]dioxadiazin-2-yl]methyl]cyclobutane-1-carboxamide.
| Compound Name | 3-[[4-[(2S)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-7-methyl-6-(1,3-oxazol-2-yl)thieno[2,3-e][1,3,2,4]dioxadiazin-2-yl]methyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 175745489 |
| Molecular Formula | C28H34N4O7S |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 3-[[4-[(2S)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-7-methyl-6-(1,3-oxazol-2-yl)thieno[2,3-e][1,3,2,4]dioxadiazin-2-yl]methyl]cyclobutane-1-carboxamide |
| SMILES | COc1ccccc1[C@@H](Cn1on(CC2CC(C(N)=O)C2)oc2c(C)c(-c3ncco3)sc21)OC1CCOCC1 |
| InChI | InChI=1S/C28H34N4O7S/c1-17-24-28(40-25(17)27-30-9-12-36-27)31(39-32(38-24)15-18-13-19(14-18)26(29)33)16-23(37-20-7-10-35-11-8-20)21-5-3-4-6-22(21)34-2/h3-6,9,12,18-20,23H,7-8,10-11,13-16H2,1-2H3,(H2,29,33)/t18?,19?,23-/m1/s1 |
| InChIKey | XIMPULLLOCJIJY-MTNXOHHFSA-N |
| XLogP | 5.24 |
| TPSA | 132.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |