About N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine
N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine (PubChem CID 155673373) has the molecular formula C20H20N4
and a molecular weight of 316.41 g/mol. Its IUPAC name is N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine.
Molecular Properties
| Compound Name | N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine |
| PubChem CID | 155673373 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine |
| SMILES | Cc1nc(N(C)c2ccc3c(c2)cc(C)n3C)c2ccccc2n1 |
| InChI | InChI=1S/C20H20N4/c1-13-11-15-12-16(9-10-19(15)23(13)3)24(4)20-17-7-5-6-8-18(17)21-14(2)22-20/h5-12H,1-4H3 |
| InChIKey | PMMMPEWURBWJPO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine?
The IUPAC name of N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine (CID 155673373) is N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine.
What is the SMILES notation for N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine?
The canonical SMILES for N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine is Cc1nc(N(C)c2ccc3c(c2)cc(C)n3C)c2ccccc2n1.
What is the InChIKey of N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine?
The InChIKey is PMMMPEWURBWJPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4/c1-13-11-15-12-16(9-10-19(15)23(13)3)24(4)20-17-7-5-6-8-18(17)21-14(2)22-20/h5-12H,1-4H3.
What are the key properties of N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine?
N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine has a molecular weight of 316.41 g/mol, XLogP of 4.51, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine is sourced from PubChem (CID 155673373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).