C20H20N4 — CID 155673373
N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine (PubChem CID 155673373) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine.
| Compound Name | N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 155673373 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-(1,2-dimethylindol-5-yl)-N,2-dimethylquinazolin-4-amine |
| SMILES | Cc1nc(N(C)c2ccc3c(c2)cc(C)n3C)c2ccccc2n1 |
| InChI | InChI=1S/C20H20N4/c1-13-11-15-12-16(9-10-19(15)23(13)3)24(4)20-17-7-5-6-8-18(17)21-14(2)22-20/h5-12H,1-4H3 |
| InChIKey | PMMMPEWURBWJPO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |