About potassium 2-aminoethanethioate
potassium 2-aminoethanethioate (PubChem CID 155674120) has the molecular formula C2H4KNOS
and a molecular weight of 129.22 g/mol. Its IUPAC name is potassium 2-aminoethanethioate.
Molecular Properties
| Compound Name | potassium 2-aminoethanethioate |
| PubChem CID | 155674120 |
| Molecular Formula | C2H4KNOS |
| Molecular Weight | 129.22 g/mol |
| Exact Mass | 128.97 |
| IUPAC Name | potassium 2-aminoethanethioate |
| SMILES | NCC([O-])=S.[K+] |
| InChI | InChI=1S/C2H5NOS.K/c3-1-2(4)5;/h1,3H2,(H,4,5);/q;+1/p-1 |
| InChIKey | WVNUAXWDZCDWHG-UHFFFAOYSA-M |
| XLogP | -4.36 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.22 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-aminoethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-aminoethanethioate?
The IUPAC name of potassium 2-aminoethanethioate (CID 155674120) is potassium 2-aminoethanethioate.
What is the SMILES notation for potassium 2-aminoethanethioate?
The canonical SMILES for potassium 2-aminoethanethioate is NCC([O-])=S.[K+].
What is the InChIKey of potassium 2-aminoethanethioate?
The InChIKey is WVNUAXWDZCDWHG-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5NOS.K/c3-1-2(4)5;/h1,3H2,(H,4,5);/q;+1/p-1.
What are the key properties of potassium 2-aminoethanethioate?
potassium 2-aminoethanethioate has a molecular weight of 129.22 g/mol, XLogP of -4.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-aminoethanethioate is sourced from PubChem (CID 155674120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).