2,4,6-triacetamidobenzoic acid

C13H15N3O5 — CID 155677349

IUPAC2,4,6-triacetamidobenzoic acid
SMILESCC(=O)Nc1cc(NC(C)=O)c(C(=O)O)c(NC(C)=O)c1
InChIInChI=1S/C13H15N3O5/c1-6(17)14-9-4-10(15-7(2)18)12(13(20)21)11(5-9)16-8(3)19/h4-5H,1-3H3,(H,14,17)(H,15,18)(H,16,19)(H,20,21)
InChIKeyJZUSQPTXELLVCD-UHFFFAOYSA-N
MW293.28 g/mol
LogP1.26
Rot. Bonds4

About 2,4,6-triacetamidobenzoic acid

2,4,6-triacetamidobenzoic acid (PubChem CID 155677349) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is 2,4,6-triacetamidobenzoic acid.

Molecular Properties

Compound Name2,4,6-triacetamidobenzoic acid
PubChem CID155677349
Molecular FormulaC13H15N3O5
Molecular Weight293.28 g/mol
Exact Mass293.10
IUPAC Name2,4,6-triacetamidobenzoic acid
SMILESCC(=O)Nc1cc(NC(C)=O)c(C(=O)O)c(NC(C)=O)c1
InChIInChI=1S/C13H15N3O5/c1-6(17)14-9-4-10(15-7(2)18)12(13(20)21)11(5-9)16-8(3)19/h4-5H,1-3H3,(H,14,17)(H,15,18)(H,16,19)(H,20,21)
InChIKeyJZUSQPTXELLVCD-UHFFFAOYSA-N
XLogP1.26
TPSA124.60 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.28
LogP ≤ 51.26
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2,4,6-triacetamidobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,6-triacetamidobenzoic acid?
The IUPAC name of 2,4,6-triacetamidobenzoic acid (CID 155677349) is 2,4,6-triacetamidobenzoic acid.
What is the SMILES notation for 2,4,6-triacetamidobenzoic acid?
The canonical SMILES for 2,4,6-triacetamidobenzoic acid is CC(=O)Nc1cc(NC(C)=O)c(C(=O)O)c(NC(C)=O)c1.
What is the InChIKey of 2,4,6-triacetamidobenzoic acid?
The InChIKey is JZUSQPTXELLVCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O5/c1-6(17)14-9-4-10(15-7(2)18)12(13(20)21)11(5-9)16-8(3)19/h4-5H,1-3H3,(H,14,17)(H,15,18)(H,16,19)(H,20,21).
What are the key properties of 2,4,6-triacetamidobenzoic acid?
2,4,6-triacetamidobenzoic acid has a molecular weight of 293.28 g/mol, XLogP of 1.26, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-triacetamidobenzoic acid is sourced from PubChem (CID 155677349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).