C15H21N3O3 — CID 23225863
3,5-diacetamido-2-tert-butylbenzamide (PubChem CID 23225863) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3,5-diacetamido-2-tert-butylbenzamide.
| Compound Name | 3,5-diacetamido-2-tert-butylbenzamide |
|---|---|
| PubChem CID | 23225863 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3,5-diacetamido-2-tert-butylbenzamide |
| SMILES | CC(=O)Nc1cc(NC(C)=O)c(C(C)(C)C)c(C(N)=O)c1 |
| InChI | InChI=1S/C15H21N3O3/c1-8(19)17-10-6-11(14(16)21)13(15(3,4)5)12(7-10)18-9(2)20/h6-7H,1-5H3,(H2,16,21)(H,17,19)(H,18,20) |
| InChIKey | RWJJTWRPEYWWLO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |