C24H22N4O4 — CID 155677608
7-[[4-(2-methoxyphenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one (PubChem CID 155677608) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is 7-[[4-(2-methoxyphenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one.
| Compound Name | 7-[[4-(2-methoxyphenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one |
|---|---|
| PubChem CID | 155677608 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 7-[[4-(2-methoxyphenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one |
| SMILES | COc1ccccc1-c1ccnc(Nc2ccc3c(N4CCOCC4)cc(=O)oc3c2)n1 |
| InChI | InChI=1S/C24H22N4O4/c1-30-21-5-3-2-4-17(21)19-8-9-25-24(27-19)26-16-6-7-18-20(28-10-12-31-13-11-28)15-23(29)32-22(18)14-16/h2-9,14-15H,10-13H2,1H3,(H,25,26,27) |
| InChIKey | DEPDCFOGWJYNAD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|