C19H16ClN3O2Se — CID 155679922
2-[(4-chlorobenzoyl)amino]-N-(2,4-dimethylphenyl)-1,3-selenazole-5-carboxamide (PubChem CID 155679922) has the molecular formula C19H16ClN3O2Se and a molecular weight of 432.77 g/mol. Its IUPAC name is 2-[(4-chlorobenzoyl)amino]-N-(2,4-dimethylphenyl)-1,3-selenazole-5-carboxamide.
| Compound Name | 2-[(4-chlorobenzoyl)amino]-N-(2,4-dimethylphenyl)-1,3-selenazole-5-carboxamide |
|---|---|
| PubChem CID | 155679922 |
| Molecular Formula | C19H16ClN3O2Se |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | 2-[(4-chlorobenzoyl)amino]-N-(2,4-dimethylphenyl)-1,3-selenazole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cnc(NC(=O)c3ccc(Cl)cc3)[se]2)c(C)c1 |
| InChI | InChI=1S/C19H16ClN3O2Se/c1-11-3-8-15(12(2)9-11)22-18(25)16-10-21-19(26-16)23-17(24)13-4-6-14(20)7-5-13/h3-10H,1-2H3,(H,22,25)(H,21,23,24) |
| InChIKey | ZUGQWVIPHOQASC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|