C18H15N3O2Se — CID 86344873
2-benzamido-N-(2-methylphenyl)-1,3-selenazole-5-carboxamide (PubChem CID 86344873) has the molecular formula C18H15N3O2Se and a molecular weight of 384.30 g/mol. Its IUPAC name is 2-benzamido-N-(2-methylphenyl)-1,3-selenazole-5-carboxamide.
| Compound Name | 2-benzamido-N-(2-methylphenyl)-1,3-selenazole-5-carboxamide |
|---|---|
| PubChem CID | 86344873 |
| Molecular Formula | C18H15N3O2Se |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 2-benzamido-N-(2-methylphenyl)-1,3-selenazole-5-carboxamide |
| SMILES | Cc1ccccc1NC(=O)c1cnc(NC(=O)c2ccccc2)[se]1 |
| InChI | InChI=1S/C18H15N3O2Se/c1-12-7-5-6-10-14(12)20-17(23)15-11-19-18(24-15)21-16(22)13-8-3-2-4-9-13/h2-11H,1H3,(H,20,23)(H,19,21,22) |
| InChIKey | OMBWQRGDLYCDFE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|