C24H31ClN2O4 — CID 155680023
tert-butyl 4-acetamido-2-butoxy-5-[(2-chlorophenyl)methylamino]benzoate (PubChem CID 155680023) has the molecular formula C24H31ClN2O4 and a molecular weight of 446.98 g/mol. Its IUPAC name is tert-butyl 4-acetamido-2-butoxy-5-[(2-chlorophenyl)methylamino]benzoate.
| Compound Name | tert-butyl 4-acetamido-2-butoxy-5-[(2-chlorophenyl)methylamino]benzoate |
|---|---|
| PubChem CID | 155680023 |
| Molecular Formula | C24H31ClN2O4 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | tert-butyl 4-acetamido-2-butoxy-5-[(2-chlorophenyl)methylamino]benzoate |
| SMILES | CCCCOc1cc(NC(C)=O)c(NCc2ccccc2Cl)cc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31ClN2O4/c1-6-7-12-30-22-14-21(27-16(2)28)20(13-18(22)23(29)31-24(3,4)5)26-15-17-10-8-9-11-19(17)25/h8-11,13-14,26H,6-7,12,15H2,1-5H3,(H,27,28) |
| InChIKey | GTCQDNYKEVXLDJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|