C25H35FN2O3 — CID 155680553
tert-butyl N-[2-[4-(benzhydrylamino)-3-fluoro-2-methylbutan-2-yl]oxyethyl]carbamate (PubChem CID 155680553) has the molecular formula C25H35FN2O3 and a molecular weight of 430.56 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(benzhydrylamino)-3-fluoro-2-methylbutan-2-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(benzhydrylamino)-3-fluoro-2-methylbutan-2-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 155680553 |
| Molecular Formula | C25H35FN2O3 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | tert-butyl N-[2-[4-(benzhydrylamino)-3-fluoro-2-methylbutan-2-yl]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOC(C)(C)C(F)CNC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35FN2O3/c1-24(2,3)31-23(29)27-16-17-30-25(4,5)21(26)18-28-22(19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,21-22,28H,16-18H2,1-5H3,(H,27,29) |
| InChIKey | NDSUGSFGIZGZRI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|